About ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate
ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate (PubChem CID 71328885) has the molecular formula C13H28O4Si
and a molecular weight of 276.45 g/mol. Its IUPAC name is ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate.
Molecular Properties
| Compound Name | ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate |
| PubChem CID | 71328885 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate |
| SMILES | CCOC(=O)C(OCC)(O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H28O4Si/c1-9-15-11(14)13(16-10-2,12(3,4)5)17-18(6,7)8/h9-10H2,1-8H3 |
| InChIKey | VVDGUMJANSONAC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate?
The IUPAC name of ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate (CID 71328885) is ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate.
What is the SMILES notation for ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate?
The canonical SMILES for ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate is CCOC(=O)C(OCC)(O[Si](C)(C)C)C(C)(C)C.
What is the InChIKey of ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate?
The InChIKey is VVDGUMJANSONAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O4Si/c1-9-15-11(14)13(16-10-2,12(3,4)5)17-18(6,7)8/h9-10H2,1-8H3.
What are the key properties of ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate?
ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate has a molecular weight of 276.45 g/mol, XLogP of 3.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate is sourced from PubChem (CID 71328885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).