C13H28O4Si — CID 71328885
ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate (PubChem CID 71328885) has the molecular formula C13H28O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate.
| Compound Name | ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 71328885 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl 2-ethoxy-3,3-dimethyl-2-trimethylsilyloxybutanoate |
| SMILES | CCOC(=O)C(OCC)(O[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H28O4Si/c1-9-15-11(14)13(16-10-2,12(3,4)5)17-18(6,7)8/h9-10H2,1-8H3 |
| InChIKey | VVDGUMJANSONAC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|