C24H40N2O3Si2 — CID 146166568
1-[(E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-3-en-1-ynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrole-2-carbonitrile (PubChem CID 146166568) has the molecular formula C24H40N2O3Si2 and a molecular weight of 460.77 g/mol. Its IUPAC name is 1-[(E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-3-en-1-ynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[(E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-3-en-1-ynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 146166568 |
| Molecular Formula | C24H40N2O3Si2 |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1-[(E,5S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhex-3-en-1-ynyl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrole-2-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(C#N)n1C#C/C=C/[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40N2O3Si2/c1-23(2,3)30(7,8)28-18-21-15-14-20(17-25)26(21)16-12-11-13-22(27)19-29-31(9,10)24(4,5)6/h11,13-15,22,27H,18-19H2,1-10H3/b13-11+/t22-/m0/s1 |
| InChIKey | CPGMMLASRQECMR-SDNYCIMKSA-N |
| XLogP | 5.63 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|