C32H52O4Si2 — CID 68636763
tert-butyl-[[4-[4-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]but-2-enoxymethyl]phenyl]methoxy]-dimethylsilane (PubChem CID 68636763) has the molecular formula C32H52O4Si2 and a molecular weight of 556.94 g/mol. Its IUPAC name is tert-butyl-[[4-[4-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]but-2-enoxymethyl]phenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[4-[4-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]but-2-enoxymethyl]phenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 68636763 |
| Molecular Formula | C32H52O4Si2 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | tert-butyl-[[4-[4-[[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methoxy]but-2-enoxymethyl]phenyl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(COCC=CCOCc2ccc(CO[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H52O4Si2/c1-31(2,3)37(7,8)35-25-29-17-13-27(14-18-29)23-33-21-11-12-22-34-24-28-15-19-30(20-16-28)26-36-38(9,10)32(4,5)6/h11-20H,21-26H2,1-10H3 |
| InChIKey | IHVGCQQRJVOYSY-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|