C21H35IO2Si — CID 134887156
(Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodopentadec-6-en-2,10-diyn-1-ol (PubChem CID 134887156) has the molecular formula C21H35IO2Si and a molecular weight of 474.50 g/mol. Its IUPAC name is (Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodopentadec-6-en-2,10-diyn-1-ol.
| Compound Name | (Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodopentadec-6-en-2,10-diyn-1-ol |
|---|---|
| PubChem CID | 134887156 |
| Molecular Formula | C21H35IO2Si |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodopentadec-6-en-2,10-diyn-1-ol |
| SMILES | CCCCC#CCC/C(I)=C/C(CC#CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H35IO2Si/c1-7-8-9-10-11-12-15-19(22)18-20(16-13-14-17-23)24-25(5,6)21(2,3)4/h18,20,23H,7-9,12,15-17H2,1-6H3/b19-18- |
| InChIKey | VMUGLPICQLBMGW-HNENSFHCSA-N |
| XLogP | 6.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|