C26H40O3Si2 — CID 135074622
(Z)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]tetradec-7-en-2,4,9,11-tetrayn-6-ol (PubChem CID 135074622) has the molecular formula C26H40O3Si2 and a molecular weight of 456.78 g/mol. Its IUPAC name is (Z)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]tetradec-7-en-2,4,9,11-tetrayn-6-ol.
| Compound Name | (Z)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]tetradec-7-en-2,4,9,11-tetrayn-6-ol |
|---|---|
| PubChem CID | 135074622 |
| Molecular Formula | C26H40O3Si2 |
| Molecular Weight | 456.78 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (Z)-1,14-bis[[tert-butyl(dimethyl)silyl]oxy]tetradec-7-en-2,4,9,11-tetrayn-6-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC#CC(O)/C=C\C#CC#CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H40O3Si2/c1-25(2,3)30(7,8)28-22-18-14-12-11-13-16-20-24(27)21-17-15-19-23-29-31(9,10)26(4,5)6/h16,20,24,27H,18,22-23H2,1-10H3/b20-16- |
| InChIKey | MBSUPEJFPNIBQA-SILNSSARSA-N |
| XLogP | 5.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.78 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|