C24H48O2Si3 — CID 134865464
[(5S,7E)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,7-dien-1-ynyl]-trimethylsilane (PubChem CID 134865464) has the molecular formula C24H48O2Si3 and a molecular weight of 452.90 g/mol. Its IUPAC name is [(5S,7E)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,7-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(5S,7E)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,7-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 134865464 |
| Molecular Formula | C24H48O2Si3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | [(5S,7E)-5,9-bis[[tert-butyl(dimethyl)silyl]oxy]nona-3,7-dien-1-ynyl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/C[C@@H](C=CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O2Si3/c1-23(2,3)28(10,11)25-20-16-14-18-22(19-15-17-21-27(7,8)9)26-29(12,13)24(4,5)6/h14-16,19,22H,18,20H2,1-13H3/b16-14+,19-15?/t22-/m0/s1 |
| InChIKey | KHHDLAVOHOWKNY-CRLMHTEISA-N |
| XLogP | 7.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|