C26H58OSi2Sn — CID 14006078
tert-butyl-dimethyl-[(Z)-3-tributylstannyl-5-trimethylsilylpent-3-en-2-yl]oxysilane (PubChem CID 14006078) has the molecular formula C26H58OSi2Sn and a molecular weight of 561.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-3-tributylstannyl-5-trimethylsilylpent-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z)-3-tributylstannyl-5-trimethylsilylpent-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 14006078 |
| Molecular Formula | C26H58OSi2Sn |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-3-tributylstannyl-5-trimethylsilylpent-3-en-2-yl]oxysilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\C[Si](C)(C)C)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H31OSi2.3C4H9.Sn/c1-13(11-10-12-16(5,6)7)15-17(8,9)14(2,3)4;3*1-3-4-2;/h10,13H,12H2,1-9H3;3*1,3-4H2,2H3; |
| InChIKey | PZONFUKBWDNVON-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|