C28H50O2Si — CID 134875012
(6E,10E)-7,11,15-trimethyl-5-tri(propan-2-yl)silyloxyhexadeca-6,10,14-trien-2-yn-1-ol (PubChem CID 134875012) has the molecular formula C28H50O2Si and a molecular weight of 446.79 g/mol. Its IUPAC name is (6E,10E)-7,11,15-trimethyl-5-tri(propan-2-yl)silyloxyhexadeca-6,10,14-trien-2-yn-1-ol.
| Compound Name | (6E,10E)-7,11,15-trimethyl-5-tri(propan-2-yl)silyloxyhexadeca-6,10,14-trien-2-yn-1-ol |
|---|---|
| PubChem CID | 134875012 |
| Molecular Formula | C28H50O2Si |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.36 |
| IUPAC Name | (6E,10E)-7,11,15-trimethyl-5-tri(propan-2-yl)silyloxyhexadeca-6,10,14-trien-2-yn-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(CC#CCO)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H50O2Si/c1-22(2)15-13-16-26(9)17-14-18-27(10)21-28(19-11-12-20-29)30-31(23(3)4,24(5)6)25(7)8/h15,17,21,23-25,28-29H,13-14,16,18-20H2,1-10H3/b26-17+,27-21+ |
| InChIKey | IXZONFAPIWOLKR-WZGXYAEVSA-N |
| XLogP | 8.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|