C25H50O2Si2 — CID 11633537
(E,3R,4R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol (PubChem CID 11633537) has the molecular formula C25H50O2Si2 and a molecular weight of 438.85 g/mol. Its IUPAC name is (E,3R,4R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol.
| Compound Name | (E,3R,4R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 11633537 |
| Molecular Formula | C25H50O2Si2 |
| Molecular Weight | 438.85 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | (E,3R,4R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol |
| SMILES | C/C(=C\CCO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H50O2Si2/c1-19(2)29(20(3)4,21(5)6)18-16-23(8)24(26)22(7)15-14-17-27-28(12,13)25(9,10)11/h15,19-21,23-24,26H,14,17H2,1-13H3/b22-15+/t23-,24+/m1/s1 |
| InChIKey | TWDNLLNHAIKTPG-NIEXSRPFSA-N |
| XLogP | 7.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.85 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|