C24H50O2Si2 — CID 102174700
(3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methyl-8-triethylsilyloxyundeca-1,5-dien-4-ol (PubChem CID 102174700) has the molecular formula C24H50O2Si2 and a molecular weight of 426.83 g/mol. Its IUPAC name is (3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methyl-8-triethylsilyloxyundeca-1,5-dien-4-ol.
| Compound Name | (3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methyl-8-triethylsilyloxyundeca-1,5-dien-4-ol |
|---|---|
| PubChem CID | 102174700 |
| Molecular Formula | C24H50O2Si2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | (3S,4S,5Z,8R)-6-[tert-butyl(dimethyl)silyl]-3-methyl-8-triethylsilyloxyundeca-1,5-dien-4-ol |
| SMILES | C=C[C@H](C)[C@H](O)/C=C(/C[C@@H](CCC)O[Si](CC)(CC)CC)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O2Si2/c1-12-17-21(26-28(14-3,15-4)16-5)18-22(19-23(25)20(6)13-2)27(10,11)24(7,8)9/h13,19-21,23,25H,2,12,14-18H2,1,3-11H3/b22-19-/t20-,21+,23+/m0/s1 |
| InChIKey | JHLHUNUJYSQAIK-SRUGDYNCSA-N |
| XLogP | 7.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|