C9H16OSi — CID 11355705
(E,2R)-6-trimethylsilylhex-3-en-5-yn-2-ol (PubChem CID 11355705) has the molecular formula C9H16OSi and a molecular weight of 168.31 g/mol. Its IUPAC name is (E,2R)-6-trimethylsilylhex-3-en-5-yn-2-ol.
| Compound Name | (E,2R)-6-trimethylsilylhex-3-en-5-yn-2-ol |
|---|---|
| PubChem CID | 11355705 |
| Molecular Formula | C9H16OSi |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (E,2R)-6-trimethylsilylhex-3-en-5-yn-2-ol |
| SMILES | C[C@@H](O)/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C9H16OSi/c1-9(10)7-5-6-8-11(2,3)4/h5,7,9-10H,1-4H3/b7-5+/t9-/m1/s1 |
| InChIKey | NTMWKDKWVVCAIW-VPIOIWJLSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|