C10H18OSi — CID 11137773
(5E)-3-trimethylsilylhepta-1,2,5-trien-4-ol (PubChem CID 11137773) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is (5E)-3-trimethylsilylhepta-1,2,5-trien-4-ol.
| Compound Name | (5E)-3-trimethylsilylhepta-1,2,5-trien-4-ol |
|---|---|
| PubChem CID | 11137773 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (5E)-3-trimethylsilylhepta-1,2,5-trien-4-ol |
| SMILES | C=C=C(C(O)/C=C/C)[Si](C)(C)C |
| InChI | InChI=1S/C10H18OSi/c1-6-8-9(11)10(7-2)12(3,4)5/h6,8-9,11H,2H2,1,3-5H3/b8-6+ |
| InChIKey | ODQOMMRZYHBBNE-SOFGYWHQSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|