C17H28O2Si — CID 146162787
(E,9R)-9-[tert-butyl(dimethyl)silyl]oxyundec-7-en-2,5-diyn-1-ol (PubChem CID 146162787) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is (E,9R)-9-[tert-butyl(dimethyl)silyl]oxyundec-7-en-2,5-diyn-1-ol.
| Compound Name | (E,9R)-9-[tert-butyl(dimethyl)silyl]oxyundec-7-en-2,5-diyn-1-ol |
|---|---|
| PubChem CID | 146162787 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (E,9R)-9-[tert-butyl(dimethyl)silyl]oxyundec-7-en-2,5-diyn-1-ol |
| SMILES | CC[C@H](/C=C/C#CCC#CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28O2Si/c1-7-16(19-20(5,6)17(2,3)4)14-12-10-8-9-11-13-15-18/h12,14,16,18H,7,9,15H2,1-6H3/b14-12+/t16-/m1/s1 |
| InChIKey | CAQDXSGJGAICIN-WCRPCQDQSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|