C14H25IO2Si — CID 134898090
(Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodooct-6-en-3-yn-1-ol (PubChem CID 134898090) has the molecular formula C14H25IO2Si and a molecular weight of 380.34 g/mol. Its IUPAC name is (Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodooct-6-en-3-yn-1-ol.
| Compound Name | (Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodooct-6-en-3-yn-1-ol |
|---|---|
| PubChem CID | 134898090 |
| Molecular Formula | C14H25IO2Si |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (Z)-5-[tert-butyl(dimethyl)silyl]oxy-7-iodooct-6-en-3-yn-1-ol |
| SMILES | C/C(I)=C/C(C#CCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H25IO2Si/c1-12(15)11-13(9-7-8-10-16)17-18(5,6)14(2,3)4/h11,13,16H,8,10H2,1-6H3/b12-11- |
| InChIKey | JFTGALCZCPULRD-QXMHVHEDSA-N |
| XLogP | 4.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|