C17H30O2Si — CID 46854919
(7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-ol (PubChem CID 46854919) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is (7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-ol.
| Compound Name | (7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-ol |
|---|---|
| PubChem CID | 46854919 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2,7-dimethylnona-2,7-dien-5-yn-4-ol |
| SMILES | CC(C)=CC(O)C#C/C(C)=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O2Si/c1-14(2)13-16(18)10-9-15(3)11-12-19-20(7,8)17(4,5)6/h11,13,16,18H,12H2,1-8H3/b15-11- |
| InChIKey | SJTLRBATNOEMLA-PTNGSMBKSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|