C11H20OSi — CID 101388632
(E,3R)-4-methyl-1-trimethylsilylhept-4-en-1-yn-3-ol (PubChem CID 101388632) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is (E,3R)-4-methyl-1-trimethylsilylhept-4-en-1-yn-3-ol.
| Compound Name | (E,3R)-4-methyl-1-trimethylsilylhept-4-en-1-yn-3-ol |
|---|---|
| PubChem CID | 101388632 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (E,3R)-4-methyl-1-trimethylsilylhept-4-en-1-yn-3-ol |
| SMILES | CC/C=C(\C)[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H20OSi/c1-6-7-10(2)11(12)8-9-13(3,4)5/h7,11-12H,6H2,1-5H3/b10-7+/t11-/m0/s1 |
| InChIKey | BVINPNOIBWOPCE-HUYFXPKMSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|