C14H24OSi — CID 15721119
(5R,6R)-2,6-dimethyl-6-trimethylsilylnona-2,3-dien-7-yn-5-ol (PubChem CID 15721119) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is (5R,6R)-2,6-dimethyl-6-trimethylsilylnona-2,3-dien-7-yn-5-ol.
| Compound Name | (5R,6R)-2,6-dimethyl-6-trimethylsilylnona-2,3-dien-7-yn-5-ol |
|---|---|
| PubChem CID | 15721119 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (5R,6R)-2,6-dimethyl-6-trimethylsilylnona-2,3-dien-7-yn-5-ol |
| SMILES | CC#C[C@](C)([C@H](O)C=C=C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H24OSi/c1-8-11-14(4,16(5,6)7)13(15)10-9-12(2)3/h10,13,15H,1-7H3/t13-,14-/m1/s1 |
| InChIKey | KQVIFSQWALSYPB-ZIAGYGMSSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|