C20H36OSi — CID 15721121
(4R,5R)-8-butyl-4-methyl-4-trimethylsilyldodeca-6,7-dien-2-yn-5-ol (PubChem CID 15721121) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is (4R,5R)-8-butyl-4-methyl-4-trimethylsilyldodeca-6,7-dien-2-yn-5-ol.
| Compound Name | (4R,5R)-8-butyl-4-methyl-4-trimethylsilyldodeca-6,7-dien-2-yn-5-ol |
|---|---|
| PubChem CID | 15721121 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (4R,5R)-8-butyl-4-methyl-4-trimethylsilyldodeca-6,7-dien-2-yn-5-ol |
| SMILES | CC#C[C@](C)([C@H](O)C=C=C(CCCC)CCCC)[Si](C)(C)C |
| InChI | InChI=1S/C20H36OSi/c1-8-11-13-18(14-12-9-2)15-16-19(21)20(4,17-10-3)22(5,6)7/h16,19,21H,8-9,11-14H2,1-7H3/t19-,20-/m1/s1 |
| InChIKey | LNVSGNJZIIQLKX-WOJBJXKFSA-N |
| XLogP | 5.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|