C18H32OSi — CID 11044553
(6E)-2,6-dimethyl-13-trimethylsilyltrideca-1,6-dien-11-yn-3-ol (PubChem CID 11044553) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is (6E)-2,6-dimethyl-13-trimethylsilyltrideca-1,6-dien-11-yn-3-ol.
| Compound Name | (6E)-2,6-dimethyl-13-trimethylsilyltrideca-1,6-dien-11-yn-3-ol |
|---|---|
| PubChem CID | 11044553 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (6E)-2,6-dimethyl-13-trimethylsilyltrideca-1,6-dien-11-yn-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C/CCCC#CC[Si](C)(C)C |
| InChI | InChI=1S/C18H32OSi/c1-16(2)18(19)14-13-17(3)12-10-8-7-9-11-15-20(4,5)6/h12,18-19H,1,7-8,10,13-15H2,2-6H3/b17-12+ |
| InChIKey | SEEBKBJIUPHOHQ-SFQUDFHCSA-N |
| XLogP | 5.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|