C22H38OSi — CID 134880944
(6Z,10Z)-7,11,15-trimethyl-1-trimethylsilylhexadeca-6,10,14-trien-1-yn-3-ol (PubChem CID 134880944) has the molecular formula C22H38OSi and a molecular weight of 346.63 g/mol. Its IUPAC name is (6Z,10Z)-7,11,15-trimethyl-1-trimethylsilylhexadeca-6,10,14-trien-1-yn-3-ol.
| Compound Name | (6Z,10Z)-7,11,15-trimethyl-1-trimethylsilylhexadeca-6,10,14-trien-1-yn-3-ol |
|---|---|
| PubChem CID | 134880944 |
| Molecular Formula | C22H38OSi |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | (6Z,10Z)-7,11,15-trimethyl-1-trimethylsilylhexadeca-6,10,14-trien-1-yn-3-ol |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\CCC(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C22H38OSi/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-22(23)17-18-24(5,6)7/h11,13,15,22-23H,8-10,12,14,16H2,1-7H3/b20-13-,21-15- |
| InChIKey | YNWPAUSFTLNAJT-SYXXZYOVSA-N |
| XLogP | 6.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|