C16H32OSi2 — CID 134931746
(Z)-1,5-bis(trimethylsilyl)dec-5-en-1-yn-3-ol (PubChem CID 134931746) has the molecular formula C16H32OSi2 and a molecular weight of 296.60 g/mol. Its IUPAC name is (Z)-1,5-bis(trimethylsilyl)dec-5-en-1-yn-3-ol.
| Compound Name | (Z)-1,5-bis(trimethylsilyl)dec-5-en-1-yn-3-ol |
|---|---|
| PubChem CID | 134931746 |
| Molecular Formula | C16H32OSi2 |
| Molecular Weight | 296.60 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (Z)-1,5-bis(trimethylsilyl)dec-5-en-1-yn-3-ol |
| SMILES | CCCC/C=C(/CC(O)C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H32OSi2/c1-8-9-10-11-16(19(5,6)7)14-15(17)12-13-18(2,3)4/h11,15,17H,8-10,14H2,1-7H3/b16-11- |
| InChIKey | WUFXTVAIUOHBFC-WJDWOHSUSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|