C14H28OSi2 — CID 71441452
5,8-bis(trimethylsilyl)oct-4-en-7-yn-1-ol (PubChem CID 71441452) has the molecular formula C14H28OSi2 and a molecular weight of 268.55 g/mol. Its IUPAC name is 5,8-bis(trimethylsilyl)oct-4-en-7-yn-1-ol.
| Compound Name | 5,8-bis(trimethylsilyl)oct-4-en-7-yn-1-ol |
|---|---|
| PubChem CID | 71441452 |
| Molecular Formula | C14H28OSi2 |
| Molecular Weight | 268.55 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5,8-bis(trimethylsilyl)oct-4-en-7-yn-1-ol |
| SMILES | C[Si](C)(C)C#CCC(=CCCCO)[Si](C)(C)C |
| InChI | InChI=1S/C14H28OSi2/c1-16(2,3)13-9-11-14(17(4,5)6)10-7-8-12-15/h10,15H,7-8,11-12H2,1-6H3 |
| InChIKey | OUTCZOZAFPVHIR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|