C11H20O2Si — CID 10488754
(Z)-8-trimethylsilyloct-3-en-7-yne-1,5-diol (PubChem CID 10488754) has the molecular formula C11H20O2Si and a molecular weight of 212.36 g/mol. Its IUPAC name is (Z)-8-trimethylsilyloct-3-en-7-yne-1,5-diol.
| Compound Name | (Z)-8-trimethylsilyloct-3-en-7-yne-1,5-diol |
|---|---|
| PubChem CID | 10488754 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (Z)-8-trimethylsilyloct-3-en-7-yne-1,5-diol |
| SMILES | C[Si](C)(C)C#CCC(O)/C=C\CCO |
| InChI | InChI=1S/C11H20O2Si/c1-14(2,3)10-6-8-11(13)7-4-5-9-12/h4,7,11-13H,5,8-9H2,1-3H3/b7-4- |
| InChIKey | QNKWDWLPBOQWKI-DAXSKMNVSA-N |
| XLogP | 1.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|