C10H18O2 — CID 18629776
(3E)-deca-3,9-diene-1,5-diol (PubChem CID 18629776) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (3E)-deca-3,9-diene-1,5-diol.
| Compound Name | (3E)-deca-3,9-diene-1,5-diol |
|---|---|
| PubChem CID | 18629776 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3E)-deca-3,9-diene-1,5-diol |
| SMILES | C=CCCCC(O)/C=C/CCO |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-7-10(12)8-5-6-9-11/h2,5,8,10-12H,1,3-4,6-7,9H2/b8-5+ |
| InChIKey | MQTUQRBLQLQAPL-VMPITWQZSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|