C17H22O — CID 162916853
(6R,7E,9E)-heptadeca-1,7,9-trien-11,13-diyn-6-ol (PubChem CID 162916853) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (6R,7E,9E)-heptadeca-1,7,9-trien-11,13-diyn-6-ol.
| Compound Name | (6R,7E,9E)-heptadeca-1,7,9-trien-11,13-diyn-6-ol |
|---|---|
| PubChem CID | 162916853 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (6R,7E,9E)-heptadeca-1,7,9-trien-11,13-diyn-6-ol |
| SMILES | C=CCCC[C@@H](O)/C=C/C=C/C#CC#CCCC |
| InChI | InChI=1S/C17H22O/c1-3-5-7-8-9-10-11-12-14-16-17(18)15-13-6-4-2/h4,11-12,14,16-18H,2-3,5-6,13,15H2,1H3/b12-11+,16-14+/t17-/m1/s1 |
| InChIKey | OZLLXPCFMABHIA-CAUYNSQMSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|