C24H26O3 — CID 44559589
[(8E,10E,12E)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynyl] benzoate (PubChem CID 44559589) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(8E,10E,12E)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynyl] benzoate.
| Compound Name | [(8E,10E,12E)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynyl] benzoate |
|---|---|
| PubChem CID | 44559589 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [(8E,10E,12E)-14-hydroxyheptadeca-8,10,12-trien-4,6-diynyl] benzoate |
| SMILES | CCCC(O)/C=C/C=C/C=C/C#CC#CCCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26O3/c1-2-17-23(25)20-15-10-8-6-4-3-5-7-9-11-16-21-27-24(26)22-18-13-12-14-19-22/h4,6,8,10,12-15,18-20,23,25H,2,11,16-17,21H2,1H3/b6-4+,10-8+,20-15+ |
| InChIKey | XGDWMJXBOWGAFH-RVHBMOCVSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|