C33H38O4 — CID 44559596
[(8E,10E,12E)-14-(phenylmethoxymethoxy)heptadeca-8,10,12-trien-4,6-diynoxy]methoxymethylbenzene (PubChem CID 44559596) has the molecular formula C33H38O4 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(8E,10E,12E)-14-(phenylmethoxymethoxy)heptadeca-8,10,12-trien-4,6-diynoxy]methoxymethylbenzene.
| Compound Name | [(8E,10E,12E)-14-(phenylmethoxymethoxy)heptadeca-8,10,12-trien-4,6-diynoxy]methoxymethylbenzene |
|---|---|
| PubChem CID | 44559596 |
| Molecular Formula | C33H38O4 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [(8E,10E,12E)-14-(phenylmethoxymethoxy)heptadeca-8,10,12-trien-4,6-diynoxy]methoxymethylbenzene |
| SMILES | CCCC(/C=C/C=C/C=C/C#CC#CCCCOCOCc1ccccc1)OCOCc1ccccc1 |
| InChI | InChI=1S/C33H38O4/c1-2-20-33(37-30-36-28-32-23-16-13-17-24-32)25-18-10-8-6-4-3-5-7-9-11-19-26-34-29-35-27-31-21-14-12-15-22-31/h4,6,8,10,12-18,21-25,33H,2,11,19-20,26-30H2,1H3/b6-4+,10-8+,25-18+ |
| InChIKey | BYEFMCFGTKXNKA-TZTNLXFQSA-N |
| XLogP | 6.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|