C25H38O3 — CID 11749515
[(E,6R,7R,10R)-7-(methoxymethoxy)-6,8,10-trimethyltridec-8-en-4-ynoxy]methylbenzene (PubChem CID 11749515) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is [(E,6R,7R,10R)-7-(methoxymethoxy)-6,8,10-trimethyltridec-8-en-4-ynoxy]methylbenzene.
| Compound Name | [(E,6R,7R,10R)-7-(methoxymethoxy)-6,8,10-trimethyltridec-8-en-4-ynoxy]methylbenzene |
|---|---|
| PubChem CID | 11749515 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | [(E,6R,7R,10R)-7-(methoxymethoxy)-6,8,10-trimethyltridec-8-en-4-ynoxy]methylbenzene |
| SMILES | CCC[C@@H](C)/C=C(\C)[C@H](OCOC)[C@H](C)C#CCCCOCc1ccccc1 |
| InChI | InChI=1S/C25H38O3/c1-6-13-21(2)18-23(4)25(28-20-26-5)22(3)14-9-8-12-17-27-19-24-15-10-7-11-16-24/h7,10-11,15-16,18,21-22,25H,6,8,12-13,17,19-20H2,1-5H3/b23-18+/t21-,22-,25-/m1/s1 |
| InChIKey | JAJSEXWJLGXRRT-KOMXPHQJSA-N |
| XLogP | 5.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|