C20H32O3 — CID 14194136
(E,2R,5S,6R)-2,4,6-trimethyl-5-(phenylmethoxymethoxy)non-3-en-1-ol (PubChem CID 14194136) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (E,2R,5S,6R)-2,4,6-trimethyl-5-(phenylmethoxymethoxy)non-3-en-1-ol.
| Compound Name | (E,2R,5S,6R)-2,4,6-trimethyl-5-(phenylmethoxymethoxy)non-3-en-1-ol |
|---|---|
| PubChem CID | 14194136 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (E,2R,5S,6R)-2,4,6-trimethyl-5-(phenylmethoxymethoxy)non-3-en-1-ol |
| SMILES | CCC[C@@H](C)[C@H](OCOCc1ccccc1)/C(C)=C/[C@@H](C)CO |
| InChI | InChI=1S/C20H32O3/c1-5-9-17(3)20(18(4)12-16(2)13-21)23-15-22-14-19-10-7-6-8-11-19/h6-8,10-12,16-17,20-21H,5,9,13-15H2,1-4H3/b18-12+/t16-,17-,20+/m1/s1 |
| InChIKey | OOHAVESUQGTKOC-ANCAQUAZSA-N |
| XLogP | 4.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|