C16H23FO3 — CID 118069123
3,5-dimethyl-2-(phenylmethoxymethoxy)hexanoyl fluoride (PubChem CID 118069123) has the molecular formula C16H23FO3 and a molecular weight of 282.35 g/mol. Its IUPAC name is 3,5-dimethyl-2-(phenylmethoxymethoxy)hexanoyl fluoride.
| Compound Name | 3,5-dimethyl-2-(phenylmethoxymethoxy)hexanoyl fluoride |
|---|---|
| PubChem CID | 118069123 |
| Molecular Formula | C16H23FO3 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3,5-dimethyl-2-(phenylmethoxymethoxy)hexanoyl fluoride |
| SMILES | CC(C)CC(C)C(OCOCc1ccccc1)C(=O)F |
| InChI | InChI=1S/C16H23FO3/c1-12(2)9-13(3)15(16(17)18)20-11-19-10-14-7-5-4-6-8-14/h4-8,12-13,15H,9-11H2,1-3H3 |
| InChIKey | GRWGPHZNBZTZQB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|