C20H24O3 — CID 102092481
(4R,5R)-4-methyl-5-phenyl-5-(phenylmethoxymethoxy)pentan-2-one (PubChem CID 102092481) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (4R,5R)-4-methyl-5-phenyl-5-(phenylmethoxymethoxy)pentan-2-one.
| Compound Name | (4R,5R)-4-methyl-5-phenyl-5-(phenylmethoxymethoxy)pentan-2-one |
|---|---|
| PubChem CID | 102092481 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (4R,5R)-4-methyl-5-phenyl-5-(phenylmethoxymethoxy)pentan-2-one |
| SMILES | CC(=O)C[C@@H](C)[C@@H](OCOCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24O3/c1-16(13-17(2)21)20(19-11-7-4-8-12-19)23-15-22-14-18-9-5-3-6-10-18/h3-12,16,20H,13-15H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | GEHJWIDKPFPKCW-OXQOHEQNSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|