C29H42O4 — CID 101419799
tert-butyl (3R,5S,7S,8S)-3,5,7-trimethyl-8-phenyl-8-(phenylmethoxymethoxy)octanoate (PubChem CID 101419799) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is tert-butyl (3R,5S,7S,8S)-3,5,7-trimethyl-8-phenyl-8-(phenylmethoxymethoxy)octanoate.
| Compound Name | tert-butyl (3R,5S,7S,8S)-3,5,7-trimethyl-8-phenyl-8-(phenylmethoxymethoxy)octanoate |
|---|---|
| PubChem CID | 101419799 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | tert-butyl (3R,5S,7S,8S)-3,5,7-trimethyl-8-phenyl-8-(phenylmethoxymethoxy)octanoate |
| SMILES | C[C@@H](CC(=O)OC(C)(C)C)C[C@H](C)C[C@H](C)[C@H](OCOCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H42O4/c1-22(17-23(2)19-27(30)33-29(4,5)6)18-24(3)28(26-15-11-8-12-16-26)32-21-31-20-25-13-9-7-10-14-25/h7-16,22-24,28H,17-21H2,1-6H3/t22-,23+,24-,28-/m0/s1 |
| InChIKey | WZDJBIBRTLDMBW-IMBSWCNGSA-N |
| XLogP | 7.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|