C24H30O5 — CID 21040751
tert-butyl (5S)-3-oxo-5,6-bis(phenylmethoxy)hexanoate (PubChem CID 21040751) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is tert-butyl (5S)-3-oxo-5,6-bis(phenylmethoxy)hexanoate.
| Compound Name | tert-butyl (5S)-3-oxo-5,6-bis(phenylmethoxy)hexanoate |
|---|---|
| PubChem CID | 21040751 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | tert-butyl (5S)-3-oxo-5,6-bis(phenylmethoxy)hexanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)C[C@@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H30O5/c1-24(2,3)29-23(26)15-21(25)14-22(28-17-20-12-8-5-9-13-20)18-27-16-19-10-6-4-7-11-19/h4-13,22H,14-18H2,1-3H3/t22-/m0/s1 |
| InChIKey | NIDSBTULOKPRER-QFIPXVFZSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|