C27H37NO5S — CID 11038252
tert-butyl (5S)-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-3-oxo-9-phenylmethoxynonanoate (PubChem CID 11038252) has the molecular formula C27H37NO5S and a molecular weight of 487.66 g/mol. Its IUPAC name is tert-butyl (5S)-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-3-oxo-9-phenylmethoxynonanoate.
| Compound Name | tert-butyl (5S)-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-3-oxo-9-phenylmethoxynonanoate |
|---|---|
| PubChem CID | 11038252 |
| Molecular Formula | C27H37NO5S |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | tert-butyl (5S)-5-[[(S)-(4-methylphenyl)sulfinyl]amino]-3-oxo-9-phenylmethoxynonanoate |
| SMILES | Cc1ccc([S@](=O)N[C@@H](CCCCOCc2ccccc2)CC(=O)CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37NO5S/c1-21-13-15-25(16-14-21)34(31)28-23(18-24(29)19-26(30)33-27(2,3)4)12-8-9-17-32-20-22-10-6-5-7-11-22/h5-7,10-11,13-16,23,28H,8-9,12,17-20H2,1-4H3/t23-,34-/m0/s1 |
| InChIKey | IVRGRLSKCIHSII-HUBRWUETSA-N |
| XLogP | 5.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|