C19H31NO4S — CID 102517360
ethyl 3,3-dimethyl-2-(4-phenylmethoxybutylsulfinylamino)butanoate (PubChem CID 102517360) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(4-phenylmethoxybutylsulfinylamino)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(4-phenylmethoxybutylsulfinylamino)butanoate |
|---|---|
| PubChem CID | 102517360 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(4-phenylmethoxybutylsulfinylamino)butanoate |
| SMILES | CCOC(=O)C(NS(=O)CCCCOCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H31NO4S/c1-5-24-18(21)17(19(2,3)4)20-25(22)14-10-9-13-23-15-16-11-7-6-8-12-16/h6-8,11-12,17,20H,5,9-10,13-15H2,1-4H3 |
| InChIKey | JDRFVUQMZYFGCX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|