C15H22BrNO3S — CID 102130542
ethyl 2-[(4-bromophenyl)methylsulfinylamino]-3,3-dimethylbutanoate (PubChem CID 102130542) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is ethyl 2-[(4-bromophenyl)methylsulfinylamino]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(4-bromophenyl)methylsulfinylamino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 102130542 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | ethyl 2-[(4-bromophenyl)methylsulfinylamino]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(NS(=O)Cc1ccc(Br)cc1)C(C)(C)C |
| InChI | InChI=1S/C15H22BrNO3S/c1-5-20-14(18)13(15(2,3)4)17-21(19)10-11-6-8-12(16)9-7-11/h6-9,13,17H,5,10H2,1-4H3 |
| InChIKey | ILNKGZKWSOXCRB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |