C31H39NO6S — CID 101073014
N-[(1S,3R)-1-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-9-phenylmethoxynonyl]-4-methylbenzenesulfinamide (PubChem CID 101073014) has the molecular formula C31H39NO6S and a molecular weight of 553.72 g/mol. Its IUPAC name is N-[(1S,3R)-1-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-9-phenylmethoxynonyl]-4-methylbenzenesulfinamide.
| Compound Name | N-[(1S,3R)-1-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-9-phenylmethoxynonyl]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 101073014 |
| Molecular Formula | C31H39NO6S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | N-[(1S,3R)-1-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-9-phenylmethoxynonyl]-4-methylbenzenesulfinamide |
| SMILES | COc1ccc([C@H](C[C@@H](O)CC(=O)CCCCOCc2ccccc2)NS(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C31H39NO6S/c1-23-12-15-28(16-13-23)39(35)32-29(25-14-17-30(36-2)31(19-25)37-3)21-27(34)20-26(33)11-7-8-18-38-22-24-9-5-4-6-10-24/h4-6,9-10,12-17,19,27,29,32,34H,7-8,11,18,20-22H2,1-3H3/t27-,29-,39?/m0/s1 |
| InChIKey | DEVGSGULONHFQS-NTKITLQUSA-N |
| XLogP | 5.46 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|