C31H38O5 — CID 164671707
(3S,5R)-3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)-9-phenylmethoxynon-1-en-5-ol (PubChem CID 164671707) has the molecular formula C31H38O5 and a molecular weight of 490.64 g/mol. Its IUPAC name is (3S,5R)-3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)-9-phenylmethoxynon-1-en-5-ol.
| Compound Name | (3S,5R)-3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)-9-phenylmethoxynon-1-en-5-ol |
|---|---|
| PubChem CID | 164671707 |
| Molecular Formula | C31H38O5 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | (3S,5R)-3-(3,4-dimethoxyphenyl)-2-(4-methoxyphenyl)-9-phenylmethoxynon-1-en-5-ol |
| SMILES | C=C(c1ccc(OC)cc1)[C@@H](C[C@H](O)CCCCOCc1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H38O5/c1-23(25-13-16-28(33-2)17-14-25)29(26-15-18-30(34-3)31(20-26)35-4)21-27(32)12-8-9-19-36-22-24-10-6-5-7-11-24/h5-7,10-11,13-18,20,27,29,32H,1,8-9,12,19,21-22H2,2-4H3/t27-,29-/m1/s1 |
| InChIKey | JFFNGQMBRNDTLJ-XRKRLSELSA-N |
| XLogP | 6.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|