C25H27NO4S — CID 10961113
(NE,S)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-4-methylbenzenesulfinamide (PubChem CID 10961113) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is (NE,S)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-4-methylbenzenesulfinamide.
| Compound Name | (NE,S)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-4-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 10961113 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (NE,S)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-4-methylbenzenesulfinamide |
| SMILES | COc1cc(/C=N/[S@@](=O)c2ccc(C)cc2)c(CCOCc2ccccc2)cc1OC |
| InChI | InChI=1S/C25H27NO4S/c1-19-9-11-23(12-10-19)31(27)26-17-22-16-25(29-3)24(28-2)15-21(22)13-14-30-18-20-7-5-4-6-8-20/h4-12,15-17H,13-14,18H2,1-3H3/b26-17+/t31-/m0/s1 |
| InChIKey | MEJQUIYXAOWJKX-USAPMUOUSA-N |
| XLogP | 4.91 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|