C22H29NO4S — CID 11036868
(NE,R)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 11036868) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is (NE,R)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 11036868 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (NE,R)-N-[[4,5-dimethoxy-2-(2-phenylmethoxyethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COc1cc(/C=N/[S@](=O)C(C)(C)C)c(CCOCc2ccccc2)cc1OC |
| InChI | InChI=1S/C22H29NO4S/c1-22(2,3)28(24)23-15-19-14-21(26-5)20(25-4)13-18(19)11-12-27-16-17-9-7-6-8-10-17/h6-10,13-15H,11-12,16H2,1-5H3/b23-15+/t28-/m1/s1 |
| InChIKey | BNVIKSWABSZOHR-AUVCNTQQSA-N |
| XLogP | 4.34 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|