C19H22O5 — CID 68682900
3,4-dimethoxy-5-(3-phenylmethoxypropyl)benzoic acid (PubChem CID 68682900) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3,4-dimethoxy-5-(3-phenylmethoxypropyl)benzoic acid.
| Compound Name | 3,4-dimethoxy-5-(3-phenylmethoxypropyl)benzoic acid |
|---|---|
| PubChem CID | 68682900 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3,4-dimethoxy-5-(3-phenylmethoxypropyl)benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(CCCOCc2ccccc2)c1OC |
| InChI | InChI=1S/C19H22O5/c1-22-17-12-16(19(20)21)11-15(18(17)23-2)9-6-10-24-13-14-7-4-3-5-8-14/h3-5,7-8,11-12H,6,9-10,13H2,1-2H3,(H,20,21) |
| InChIKey | QLKBPBGEBMUUAV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|