C20H31NO2S — CID 90205741
(NE,R)-2-methyl-N-[[4-(2-phenylmethoxyethyl)cyclohexyl]methylidene]propane-2-sulfinamide (PubChem CID 90205741) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[[4-(2-phenylmethoxyethyl)cyclohexyl]methylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[[4-(2-phenylmethoxyethyl)cyclohexyl]methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 90205741 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (NE,R)-2-methyl-N-[[4-(2-phenylmethoxyethyl)cyclohexyl]methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/C1CCC(CCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H31NO2S/c1-20(2,3)24(22)21-15-18-11-9-17(10-12-18)13-14-23-16-19-7-5-4-6-8-19/h4-8,15,17-18H,9-14,16H2,1-3H3/b21-15+/t17?,18?,24-/m1/s1 |
| InChIKey | KBNDSRUBNDVLIC-AXXZJNQKSA-N |
| XLogP | 4.93 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|