C13H19NOS2 — CID 162413640
(NZ,R)-N-(2-benzylsulfanylethylidene)-2-methylpropane-2-sulfinamide (PubChem CID 162413640) has the molecular formula C13H19NOS2 and a molecular weight of 269.44 g/mol. Its IUPAC name is (NZ,R)-N-(2-benzylsulfanylethylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NZ,R)-N-(2-benzylsulfanylethylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162413640 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (NZ,R)-N-(2-benzylsulfanylethylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C\CSCc1ccccc1 |
| InChI | InChI=1S/C13H19NOS2/c1-13(2,3)17(15)14-9-10-16-11-12-7-5-4-6-8-12/h4-9H,10-11H2,1-3H3/b14-9-/t17-/m1/s1 |
| InChIKey | XRLJSUKBACWEIB-CRPZLVSXSA-N |
| XLogP | 3.45 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|