C15H15NOS — CID 10563115
(NE,S)-4-methyl-N-(2-phenylethylidene)benzenesulfinamide (PubChem CID 10563115) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is (NE,S)-4-methyl-N-(2-phenylethylidene)benzenesulfinamide.
| Compound Name | (NE,S)-4-methyl-N-(2-phenylethylidene)benzenesulfinamide |
|---|---|
| PubChem CID | 10563115 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (NE,S)-4-methyl-N-(2-phenylethylidene)benzenesulfinamide |
| SMILES | Cc1ccc([S@](=O)/N=C/Cc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15NOS/c1-13-7-9-15(10-8-13)18(17)16-12-11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3/b16-12+/t18-/m0/s1 |
| InChIKey | UQSNGRRUDQIWKY-QIPRVMPFSA-N |
| XLogP | 3.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|