C10H13NOS — CID 11095545
(NE,S)-4-methyl-N-propylidenebenzenesulfinamide (PubChem CID 11095545) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is (NE,S)-4-methyl-N-propylidenebenzenesulfinamide.
| Compound Name | (NE,S)-4-methyl-N-propylidenebenzenesulfinamide |
|---|---|
| PubChem CID | 11095545 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (NE,S)-4-methyl-N-propylidenebenzenesulfinamide |
| SMILES | CC/C=N/[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H13NOS/c1-3-8-11-13(12)10-6-4-9(2)5-7-10/h4-8H,3H2,1-2H3/b11-8+/t13-/m0/s1 |
| InChIKey | HQAYHCNFFJGTEZ-YKWSONSWSA-N |
| XLogP | 2.50 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|