C17H23ClO5 — CID 141122151
tert-butyl (5S)-6-[(4-chlorophenyl)methoxy]-5-hydroxy-3-oxohexanoate (PubChem CID 141122151) has the molecular formula C17H23ClO5 and a molecular weight of 342.82 g/mol. Its IUPAC name is tert-butyl (5S)-6-[(4-chlorophenyl)methoxy]-5-hydroxy-3-oxohexanoate.
| Compound Name | tert-butyl (5S)-6-[(4-chlorophenyl)methoxy]-5-hydroxy-3-oxohexanoate |
|---|---|
| PubChem CID | 141122151 |
| Molecular Formula | C17H23ClO5 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | tert-butyl (5S)-6-[(4-chlorophenyl)methoxy]-5-hydroxy-3-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)CC(=O)C[C@H](O)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClO5/c1-17(2,3)23-16(21)9-14(19)8-15(20)11-22-10-12-4-6-13(18)7-5-12/h4-7,15,20H,8-11H2,1-3H3/t15-/m0/s1 |
| InChIKey | BHLYTBLSADUARG-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|