C19H30O4 — CID 172759732
tert-butyl 4-methoxy-2,2-dimethyl-5-phenylmethoxypentanoate (PubChem CID 172759732) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is tert-butyl 4-methoxy-2,2-dimethyl-5-phenylmethoxypentanoate.
| Compound Name | tert-butyl 4-methoxy-2,2-dimethyl-5-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 172759732 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl 4-methoxy-2,2-dimethyl-5-phenylmethoxypentanoate |
| SMILES | COC(COCc1ccccc1)CC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30O4/c1-18(2,3)23-17(20)19(4,5)12-16(21-6)14-22-13-15-10-8-7-9-11-15/h7-11,16H,12-14H2,1-6H3 |
| InChIKey | LNCBTSZIJTUIIT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |