C17H25NO5 — CID 67023671
methyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylmethoxypropanoate (PubChem CID 67023671) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylmethoxypropanoate.
| Compound Name | methyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 67023671 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | methyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylmethoxypropanoate |
| SMILES | COC(=O)C(COCc1ccccc1)NCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO5/c1-17(2,3)23-15(19)10-18-14(16(20)21-4)12-22-11-13-8-6-5-7-9-13/h5-9,14,18H,10-12H2,1-4H3 |
| InChIKey | FCOGLOQPTMHGOH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |