C20H31NO6 — CID 59347976
(3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethoxy)hexanoic acid (PubChem CID 59347976) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethoxy)hexanoic acid.
| Compound Name | (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethoxy)hexanoic acid |
|---|---|
| PubChem CID | 59347976 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxymethoxy)hexanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(OCOCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H31NO6/c1-14(2)11-16(21-19(24)27-20(3,4)5)17(18(22)23)26-13-25-12-15-9-7-6-8-10-15/h6-10,14,16-17H,11-13H2,1-5H3,(H,21,24)(H,22,23)/t16-,17?/m0/s1 |
| InChIKey | VJFZJMDHWBUFAF-BHWOMJMDSA-N |
| XLogP | 3.57 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|