C26H32O3 — CID 23253490
(4R,5S)-4-ethenyl-1,10-bis(phenylmethoxy)dec-6-yn-5-ol (PubChem CID 23253490) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is (4R,5S)-4-ethenyl-1,10-bis(phenylmethoxy)dec-6-yn-5-ol.
| Compound Name | (4R,5S)-4-ethenyl-1,10-bis(phenylmethoxy)dec-6-yn-5-ol |
|---|---|
| PubChem CID | 23253490 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (4R,5S)-4-ethenyl-1,10-bis(phenylmethoxy)dec-6-yn-5-ol |
| SMILES | C=C[C@@H](CCCOCc1ccccc1)[C@H](O)C#CCCCOCc1ccccc1 |
| InChI | InChI=1S/C26H32O3/c1-2-25(17-12-20-29-22-24-15-8-4-9-16-24)26(27)18-10-5-11-19-28-21-23-13-6-3-7-14-23/h2-4,6-9,13-16,25-27H,1,5,11-12,17,19-22H2/t25-,26+/m0/s1 |
| InChIKey | PAIICMVKKJRANL-IZZNHLLZSA-N |
| XLogP | 5.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|